C24H28N2O4 — CID 8507218
(5S)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione (PubChem CID 8507218) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (5S)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 8507218 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (5S)-5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-[2-oxo-2-(4-propan-2-ylphenyl)ethyl]imidazolidine-2,4-dione |
| SMILES | COc1ccc(CC[C@]2(C)NC(=O)N(CC(=O)c3ccc(C(C)C)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H28N2O4/c1-16(2)18-7-9-19(10-8-18)21(27)15-26-22(28)24(3,25-23(26)29)14-13-17-5-11-20(30-4)12-6-17/h5-12,16H,13-15H2,1-4H3,(H,25,29)/t24-/m0/s1 |
| InChIKey | CMOZOQGULMMOIC-DEOSSOPVSA-N |
| XLogP | 3.94 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|