C19H20N2O4S — CID 17428620
5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione (PubChem CID 17428620) has the molecular formula C19H20N2O4S and a molecular weight of 372.45 g/mol. Its IUPAC name is 5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione.
| Compound Name | 5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17428620 |
| Molecular Formula | C19H20N2O4S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | 5-[2-(4-methoxyphenyl)ethyl]-5-methyl-3-(2-oxo-2-thiophen-2-ylethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(CCC2(C)NC(=O)N(CC(=O)c3cccs3)C2=O)cc1 |
| InChI | InChI=1S/C19H20N2O4S/c1-19(10-9-13-5-7-14(25-2)8-6-13)17(23)21(18(24)20-19)12-15(22)16-4-3-11-26-16/h3-8,11H,9-10,12H2,1-2H3,(H,20,24) |
| InChIKey | QZYNQCBXRWCOMI-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|