C22H22F2N2O4 — CID 7595850
(5S)-3-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione (PubChem CID 7595850) has the molecular formula C22H22F2N2O4 and a molecular weight of 416.42 g/mol. Its IUPAC name is (5S)-3-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-3-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7595850 |
| Molecular Formula | C22H22F2N2O4 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | (5S)-3-[2-[4-(difluoromethoxy)phenyl]-2-oxoethyl]-5-methyl-5-(4-propan-2-ylphenyl)imidazolidine-2,4-dione |
| SMILES | CC(C)c1ccc([C@]2(C)NC(=O)N(CC(=O)c3ccc(OC(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C22H22F2N2O4/c1-13(2)14-4-8-16(9-5-14)22(3)19(28)26(21(29)25-22)12-18(27)15-6-10-17(11-7-15)30-20(23)24/h4-11,13,20H,12H2,1-3H3,(H,25,29)/t22-/m0/s1 |
| InChIKey | YGNDSOHOFGDTPL-QFIPXVFZSA-N |
| XLogP | 4.06 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|