C18H23F2N3O4 — CID 2703224
2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methylbutyl)acetamide (PubChem CID 2703224) has the molecular formula C18H23F2N3O4 and a molecular weight of 383.40 g/mol. Its IUPAC name is 2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methylbutyl)acetamide.
| Compound Name | 2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methylbutyl)acetamide |
|---|---|
| PubChem CID | 2703224 |
| Molecular Formula | C18H23F2N3O4 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | 2-[(4S)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methylbutyl)acetamide |
| SMILES | CC(C)CCNC(=O)CN1C(=O)N[C@@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C18H23F2N3O4/c1-11(2)8-9-21-14(24)10-23-15(25)18(3,22-17(23)26)12-4-6-13(7-5-12)27-16(19)20/h4-7,11,16H,8-10H2,1-3H3,(H,21,24)(H,22,26)/t18-/m0/s1 |
| InChIKey | XQMVXIWMZGODJR-SFHVURJKSA-N |
| XLogP | 2.22 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|