C17H21F2N3O4 — CID 2703220
N-[(2R)-butan-2-yl]-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 2703220) has the molecular formula C17H21F2N3O4 and a molecular weight of 369.37 g/mol. Its IUPAC name is N-[(2R)-butan-2-yl]-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[(2R)-butan-2-yl]-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 2703220 |
| Molecular Formula | C17H21F2N3O4 |
| Molecular Weight | 369.37 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | N-[(2R)-butan-2-yl]-2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CC[C@@H](C)NC(=O)CN1C(=O)N[C@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H21F2N3O4/c1-4-10(2)20-13(23)9-22-14(24)17(3,21-16(22)25)11-5-7-12(8-6-11)26-15(18)19/h5-8,10,15H,4,9H2,1-3H3,(H,20,23)(H,21,25)/t10-,17-/m1/s1 |
| InChIKey | RKVYQHFKYKXBAO-BMLIUANNSA-N |
| XLogP | 1.97 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|