C17H19F2N3O4 — CID 2703300
(5R)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione (PubChem CID 2703300) has the molecular formula C17H19F2N3O4 and a molecular weight of 367.35 g/mol. Its IUPAC name is (5R)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2703300 |
| Molecular Formula | C17H19F2N3O4 |
| Molecular Weight | 367.35 g/mol |
| Exact Mass | 367.13 |
| IUPAC Name | (5R)-5-[4-(difluoromethoxy)phenyl]-5-methyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccc(OC(F)F)cc2)NC(=O)N(CC(=O)N2CCCC2)C1=O |
| InChI | InChI=1S/C17H19F2N3O4/c1-17(11-4-6-12(7-5-11)26-15(18)19)14(24)22(16(25)20-17)10-13(23)21-8-2-3-9-21/h4-7,15H,2-3,8-10H2,1H3,(H,20,25)/t17-/m1/s1 |
| InChIKey | PGVBPQXOYUHXJQ-QGZVFWFLSA-N |
| XLogP | 1.68 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.35 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|