C19H25F2N3O5 — CID 8571513
2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 8571513) has the molecular formula C19H25F2N3O5 and a molecular weight of 413.42 g/mol. Its IUPAC name is 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 8571513 |
| Molecular Formula | C19H25F2N3O5 |
| Molecular Weight | 413.42 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CC(C)OCCCNC(=O)CN1C(=O)N[C@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C19H25F2N3O5/c1-12(2)28-10-4-9-22-15(25)11-24-16(26)19(3,23-18(24)27)13-5-7-14(8-6-13)29-17(20)21/h5-8,12,17H,4,9-11H2,1-3H3,(H,22,25)(H,23,27)/t19-/m1/s1 |
| InChIKey | SCTIIUUJXQSWER-LJQANCHMSA-N |
| XLogP | 1.99 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.42 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|