C17H21F2N3O5 — CID 2421632
2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methoxypropyl)acetamide (PubChem CID 2421632) has the molecular formula C17H21F2N3O5 and a molecular weight of 385.37 g/mol. Its IUPAC name is 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 2421632 |
| Molecular Formula | C17H21F2N3O5 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | 2-[(4R)-4-[4-(difluoromethoxy)phenyl]-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN1C(=O)N[C@](C)(c2ccc(OC(F)F)cc2)C1=O |
| InChI | InChI=1S/C17H21F2N3O5/c1-17(11-4-6-12(7-5-11)27-15(18)19)14(24)22(16(25)21-17)10-13(23)20-8-3-9-26-2/h4-7,15H,3,8-10H2,1-2H3,(H,20,23)(H,21,25)/t17-/m1/s1 |
| InChIKey | JJJCSILWNYEFQE-QGZVFWFLSA-N |
| XLogP | 1.21 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|