C15H16N2O5 — CID 119052968
methyl 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzoate (PubChem CID 119052968) has the molecular formula C15H16N2O5 and a molecular weight of 304.30 g/mol. Its IUPAC name is methyl 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzoate.
| Compound Name | methyl 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzoate |
|---|---|
| PubChem CID | 119052968 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | methyl 3-[2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)acetyl]benzoate |
| SMILES | COC(=O)c1cccc(C(=O)CN2C(=O)NC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C15H16N2O5/c1-15(2)13(20)17(14(21)16-15)8-11(18)9-5-4-6-10(7-9)12(19)22-3/h4-7H,8H2,1-3H3,(H,16,21) |
| InChIKey | JHFUBFZUEPCNOL-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|