C17H19N3O5 — CID 16557283
methyl 3-[[2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoate (PubChem CID 16557283) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is methyl 3-[[2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoate.
| Compound Name | methyl 3-[[2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 16557283 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | methyl 3-[[2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetyl]amino]benzoate |
| SMILES | COC(=O)c1cccc(NC(=O)CN2C(=O)NC(C)(C3CC3)C2=O)c1 |
| InChI | InChI=1S/C17H19N3O5/c1-17(11-6-7-11)15(23)20(16(24)19-17)9-13(21)18-12-5-3-4-10(8-12)14(22)25-2/h3-5,8,11H,6-7,9H2,1-2H3,(H,18,21)(H,19,24) |
| InChIKey | KEHPSJGKXQUYHB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|