C15H16Cl2N4O3 — CID 46665102
N-(4-amino-3,5-dichlorophenyl)-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide (PubChem CID 46665102) has the molecular formula C15H16Cl2N4O3 and a molecular weight of 371.22 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 46665102 |
| Molecular Formula | C15H16Cl2N4O3 |
| Molecular Weight | 371.22 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl)acetamide |
| SMILES | CC1(C2CC2)NC(=O)N(CC(=O)Nc2cc(Cl)c(N)c(Cl)c2)C1=O |
| InChI | InChI=1S/C15H16Cl2N4O3/c1-15(7-2-3-7)13(23)21(14(24)20-15)6-11(22)19-8-4-9(16)12(18)10(17)5-8/h4-5,7H,2-3,6,18H2,1H3,(H,19,22)(H,20,24) |
| InChIKey | GLGTWIWSYXFJKH-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.22 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|