C20H26N4O5S — CID 41102906
2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide (PubChem CID 41102906) has the molecular formula C20H26N4O5S and a molecular weight of 434.52 g/mol. Its IUPAC name is 2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide.
| Compound Name | 2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
|---|---|
| PubChem CID | 41102906 |
| Molecular Formula | C20H26N4O5S |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.16 |
| IUPAC Name | 2-[(4R)-4-cyclopropyl-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(3-piperidin-1-ylsulfonylphenyl)acetamide |
| SMILES | C[C@]1(C2CC2)NC(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N3CCCCC3)c2)C1=O |
| InChI | InChI=1S/C20H26N4O5S/c1-20(14-8-9-14)18(26)24(19(27)22-20)13-17(25)21-15-6-5-7-16(12-15)30(28,29)23-10-3-2-4-11-23/h5-7,12,14H,2-4,8-11,13H2,1H3,(H,21,25)(H,22,27)/t20-/m1/s1 |
| InChIKey | BAIDCPWXWOTPHU-HXUWFJFHSA-N |
| XLogP | 1.52 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|