C20H28N4O5S2 — CID 26860666
N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 26860666) has the molecular formula C20H28N4O5S2 and a molecular weight of 468.60 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 26860666 |
| Molecular Formula | C20H28N4O5S2 |
| Molecular Weight | 468.60 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-2-[(4R)-4-(2-methylsulfanylethyl)-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CSCC[C@H]1NC(=O)N(CC(=O)Nc2cccc(S(=O)(=O)N3CCCCCC3)c2)C1=O |
| InChI | InChI=1S/C20H28N4O5S2/c1-30-12-9-17-19(26)24(20(27)22-17)14-18(25)21-15-7-6-8-16(13-15)31(28,29)23-10-4-2-3-5-11-23/h6-8,13,17H,2-5,9-12,14H2,1H3,(H,21,25)(H,22,27)/t17-/m1/s1 |
| InChIKey | XRRYNWWMTUUKML-QGZVFWFLSA-N |
| XLogP | 1.86 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|