C19H28N2O4S — CID 55604794
N-[3-(azepan-1-ylsulfonyl)phenyl]-3-(oxolan-2-yl)propanamide (PubChem CID 55604794) has the molecular formula C19H28N2O4S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[3-(azepan-1-ylsulfonyl)phenyl]-3-(oxolan-2-yl)propanamide.
| Compound Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-3-(oxolan-2-yl)propanamide |
|---|---|
| PubChem CID | 55604794 |
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.18 |
| IUPAC Name | N-[3-(azepan-1-ylsulfonyl)phenyl]-3-(oxolan-2-yl)propanamide |
| SMILES | O=C(CCC1CCCO1)Nc1cccc(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C19H28N2O4S/c22-19(11-10-17-8-6-14-25-17)20-16-7-5-9-18(15-16)26(23,24)21-12-3-1-2-4-13-21/h5,7,9,15,17H,1-4,6,8,10-14H2,(H,20,22) |
| InChIKey | RDCOZQTXAPYMHJ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |