C23H28N2O4S2 — CID 40986092
2-[[(2S)-oxolan-2-yl]methylsulfanyl]-N-(3-piperidin-1-ylsulfonylphenyl)benzamide (PubChem CID 40986092) has the molecular formula C23H28N2O4S2 and a molecular weight of 460.62 g/mol. Its IUPAC name is 2-[[(2S)-oxolan-2-yl]methylsulfanyl]-N-(3-piperidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 2-[[(2S)-oxolan-2-yl]methylsulfanyl]-N-(3-piperidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 40986092 |
| Molecular Formula | C23H28N2O4S2 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.15 |
| IUPAC Name | 2-[[(2S)-oxolan-2-yl]methylsulfanyl]-N-(3-piperidin-1-ylsulfonylphenyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)N2CCCCC2)c1)c1ccccc1SC[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H28N2O4S2/c26-23(21-11-2-3-12-22(21)30-17-19-9-7-15-29-19)24-18-8-6-10-20(16-18)31(27,28)25-13-4-1-5-14-25/h2-3,6,8,10-12,16,19H,1,4-5,7,9,13-15,17H2,(H,24,26)/t19-/m0/s1 |
| InChIKey | NYKZAAIAMJBCIN-IBGZPJMESA-N |
| XLogP | 4.38 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |