C21H24N2O4S2 — CID 55477836
N-[3-(cyclopropylsulfamoyl)phenyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide (PubChem CID 55477836) has the molecular formula C21H24N2O4S2 and a molecular weight of 432.57 g/mol. Its IUPAC name is N-[3-(cyclopropylsulfamoyl)phenyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-[3-(cyclopropylsulfamoyl)phenyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55477836 |
| Molecular Formula | C21H24N2O4S2 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.12 |
| IUPAC Name | N-[3-(cyclopropylsulfamoyl)phenyl]-2-(oxolan-2-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccc(S(=O)(=O)NC2CC2)c1)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C21H24N2O4S2/c24-21(19-8-1-2-9-20(19)28-14-17-6-4-12-27-17)22-16-5-3-7-18(13-16)29(25,26)23-15-10-11-15/h1-3,5,7-9,13,15,17,23H,4,6,10-12,14H2,(H,22,24) |
| InChIKey | SHGZENTVIQKDKV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |