C19H22N2O5S2 — CID 55395683
N-(4-methoxy-3-sulfamoylphenyl)-2-(oxolan-2-ylmethylsulfanyl)benzamide (PubChem CID 55395683) has the molecular formula C19H22N2O5S2 and a molecular weight of 422.53 g/mol. Its IUPAC name is N-(4-methoxy-3-sulfamoylphenyl)-2-(oxolan-2-ylmethylsulfanyl)benzamide.
| Compound Name | N-(4-methoxy-3-sulfamoylphenyl)-2-(oxolan-2-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 55395683 |
| Molecular Formula | C19H22N2O5S2 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | N-(4-methoxy-3-sulfamoylphenyl)-2-(oxolan-2-ylmethylsulfanyl)benzamide |
| SMILES | COc1ccc(NC(=O)c2ccccc2SCC2CCCO2)cc1S(N)(=O)=O |
| InChI | InChI=1S/C19H22N2O5S2/c1-25-16-9-8-13(11-18(16)28(20,23)24)21-19(22)15-6-2-3-7-17(15)27-12-14-5-4-10-26-14/h2-3,6-9,11,14H,4-5,10,12H2,1H3,(H,21,22)(H2,20,23,24) |
| InChIKey | GKASOHJLJTZGEF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |