C25H25N3O3S — CID 24676894
2-(oxolan-2-ylmethylsulfanyl)-N-[4-(phenylcarbamoylamino)phenyl]benzamide (PubChem CID 24676894) has the molecular formula C25H25N3O3S and a molecular weight of 447.56 g/mol. Its IUPAC name is 2-(oxolan-2-ylmethylsulfanyl)-N-[4-(phenylcarbamoylamino)phenyl]benzamide.
| Compound Name | 2-(oxolan-2-ylmethylsulfanyl)-N-[4-(phenylcarbamoylamino)phenyl]benzamide |
|---|---|
| PubChem CID | 24676894 |
| Molecular Formula | C25H25N3O3S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.16 |
| IUPAC Name | 2-(oxolan-2-ylmethylsulfanyl)-N-[4-(phenylcarbamoylamino)phenyl]benzamide |
| SMILES | O=C(Nc1ccccc1)Nc1ccc(NC(=O)c2ccccc2SCC2CCCO2)cc1 |
| InChI | InChI=1S/C25H25N3O3S/c29-24(22-10-4-5-11-23(22)32-17-21-9-6-16-31-21)26-19-12-14-20(15-13-19)28-25(30)27-18-7-2-1-3-8-18/h1-5,7-8,10-15,21H,6,9,16-17H2,(H,26,29)(H2,27,28,30) |
| InChIKey | ZVOVZOBNRJVOII-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |