C24H32N3O2S+ — CID 9291506
N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide (PubChem CID 9291506) has the molecular formula C24H32N3O2S+ and a molecular weight of 426.61 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide.
| Compound Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9291506 |
| Molecular Formula | C24H32N3O2S+ |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.22 |
| IUPAC Name | N-[4-(4-ethylpiperazin-4-ium-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
| SMILES | CC[NH+]1CCN(c2ccc(NC(=O)c3ccccc3SC[C@H]3CCCO3)cc2)CC1 |
| InChI | InChI=1S/C24H31N3O2S/c1-2-26-13-15-27(16-14-26)20-11-9-19(10-12-20)25-24(28)22-7-3-4-8-23(22)30-18-21-6-5-17-29-21/h3-4,7-12,21H,2,5-6,13-18H2,1H3,(H,25,28)/p+1/t21-/m1/s1 |
| InChIKey | KBCJVKWFHAIYHN-OAQYLSRUSA-O |
| XLogP | 2.93 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|