C24H28N2O4S — CID 55425589
[2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55425589) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55425589 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | [2-oxo-2-(4-pyrrolidin-1-ylanilino)ethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1SCC1CCCO1)Nc1ccc(N2CCCC2)cc1 |
| InChI | InChI=1S/C24H28N2O4S/c27-23(25-18-9-11-19(12-10-18)26-13-3-4-14-26)16-30-24(28)21-7-1-2-8-22(21)31-17-20-6-5-15-29-20/h1-2,7-12,20H,3-6,13-17H2,(H,25,27) |
| InChIKey | NDJMAHRGZVONQY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|