C24H27N3O6S — CID 55405518
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate (PubChem CID 55405518) has the molecular formula C24H27N3O6S and a molecular weight of 485.56 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
|---|---|
| PubChem CID | 55405518 |
| Molecular Formula | C24H27N3O6S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.16 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-(oxolan-2-ylmethylsulfanyl)benzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccccc1SCC1CCCO1 |
| InChI | InChI=1S/C24H27N3O6S/c28-23(26-13-11-25(12-14-26)18-7-9-19(10-8-18)27(30)31)16-33-24(29)21-5-1-2-6-22(21)34-17-20-4-3-15-32-20/h1-2,5-10,20H,3-4,11-17H2 |
| InChIKey | GVGJIWFZZFCISC-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 102.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|