C23H23N5O7 — CID 24604382
[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 24604382) has the molecular formula C23H23N5O7 and a molecular weight of 481.47 g/mol. Its IUPAC name is [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 24604382 |
| Molecular Formula | C23H23N5O7 |
| Molecular Weight | 481.47 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCC(=O)N1CCN(c2ccc([N+](=O)[O-])cc2)CC1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C23H23N5O7/c29-20-13-24-23(32)27(20)14-16-3-1-2-4-19(16)22(31)35-15-21(30)26-11-9-25(10-12-26)17-5-7-18(8-6-17)28(33)34/h1-8H,9-15H2,(H,24,32) |
| InChIKey | RLNNNIAJQCGYSF-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 142.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.47 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|