C18H21N3O5 — CID 18133845
(2-oxo-2-piperidin-1-ylethyl) 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 18133845) has the molecular formula C18H21N3O5 and a molecular weight of 359.38 g/mol. Its IUPAC name is (2-oxo-2-piperidin-1-ylethyl) 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 18133845 |
| Molecular Formula | C18H21N3O5 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | (2-oxo-2-piperidin-1-ylethyl) 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCC(=O)N1CCCCC1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C18H21N3O5/c22-15-10-19-18(25)21(15)11-13-6-2-3-7-14(13)17(24)26-12-16(23)20-8-4-1-5-9-20/h2-3,6-7H,1,4-5,8-12H2,(H,19,25) |
| InChIKey | QVGPKHCLGNWURW-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|