C20H19N3O3 — CID 17455085
3-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]imidazolidine-2,4-dione (PubChem CID 17455085) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is 3-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]imidazolidine-2,4-dione.
| Compound Name | 3-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 17455085 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 3-[[2-(3,4-dihydro-1H-isoquinoline-2-carbonyl)phenyl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C(c1ccccc1CN1C(=O)CNC1=O)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C20H19N3O3/c24-18-11-21-20(26)23(18)13-16-7-3-4-8-17(16)19(25)22-10-9-14-5-1-2-6-15(14)12-22/h1-8H,9-13H2,(H,21,26) |
| InChIKey | IBGNCYMICXLCEL-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|