C27H23N3O5 — CID 24669491
[2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 24669491) has the molecular formula C27H23N3O5 and a molecular weight of 469.50 g/mol. Its IUPAC name is [2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | [2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 24669491 |
| Molecular Formula | C27H23N3O5 |
| Molecular Weight | 469.50 g/mol |
| Exact Mass | 469.16 |
| IUPAC Name | [2-(5,6-dihydrobenzo[b][1]benzazepin-11-yl)-2-oxoethyl] 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCC(=O)N1c2ccccc2CCc2ccccc21)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C27H23N3O5/c31-24-15-28-27(34)29(24)16-20-9-1-4-10-21(20)26(33)35-17-25(32)30-22-11-5-2-7-18(22)13-14-19-8-3-6-12-23(19)30/h1-12H,13-17H2,(H,28,34) |
| InChIKey | GGKRLTWAVFCQLB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|