C16H18N2O5 — CID 51075280
oxolan-2-ylmethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate (PubChem CID 51075280) has the molecular formula C16H18N2O5 and a molecular weight of 318.33 g/mol. Its IUPAC name is oxolan-2-ylmethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate.
| Compound Name | oxolan-2-ylmethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 51075280 |
| Molecular Formula | C16H18N2O5 |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | oxolan-2-ylmethyl 2-[(2,5-dioxoimidazolidin-1-yl)methyl]benzoate |
| SMILES | O=C(OCC1CCCO1)c1ccccc1CN1C(=O)CNC1=O |
| InChI | InChI=1S/C16H18N2O5/c19-14-8-17-16(21)18(14)9-11-4-1-2-6-13(11)15(20)23-10-12-5-3-7-22-12/h1-2,4,6,12H,3,5,7-10H2,(H,17,21) |
| InChIKey | ZHICJAMEFQVUTM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|