C19H19NO4 — CID 40820524
[(2R)-oxolan-2-yl]methyl 2-benzamidobenzoate (PubChem CID 40820524) has the molecular formula C19H19NO4 and a molecular weight of 325.36 g/mol. Its IUPAC name is [(2R)-oxolan-2-yl]methyl 2-benzamidobenzoate.
| Compound Name | [(2R)-oxolan-2-yl]methyl 2-benzamidobenzoate |
|---|---|
| PubChem CID | 40820524 |
| Molecular Formula | C19H19NO4 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(2R)-oxolan-2-yl]methyl 2-benzamidobenzoate |
| SMILES | O=C(Nc1ccccc1C(=O)OC[C@H]1CCCO1)c1ccccc1 |
| InChI | InChI=1S/C19H19NO4/c21-18(14-7-2-1-3-8-14)20-17-11-5-4-10-16(17)19(22)24-13-15-9-6-12-23-15/h1-5,7-8,10-11,15H,6,9,12-13H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | NRESBRBGFXYMDJ-OAHLLOKOSA-N |
| XLogP | 3.27 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |