C24H28N2O4 — CID 31287648
N-cyclopentyl-2-[[4-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzamide (PubChem CID 31287648) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is N-cyclopentyl-2-[[4-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzamide.
| Compound Name | N-cyclopentyl-2-[[4-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzamide |
|---|---|
| PubChem CID | 31287648 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | N-cyclopentyl-2-[[4-[[(2R)-oxolan-2-yl]methoxy]benzoyl]amino]benzamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CCCC1)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C24H28N2O4/c27-23(17-11-13-19(14-12-17)30-16-20-8-5-15-29-20)26-22-10-4-3-9-21(22)24(28)25-18-6-1-2-7-18/h3-4,9-14,18,20H,1-2,5-8,15-16H2,(H,25,28)(H,26,27)/t20-/m1/s1 |
| InChIKey | RFQWYSQSRJCWRQ-HXUWFJFHSA-N |
| XLogP | 4.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |