C20H23NO3 — CID 7750856
N-(2-ethylphenyl)-4-[[(2R)-oxolan-2-yl]methoxy]benzamide (PubChem CID 7750856) has the molecular formula C20H23NO3 and a molecular weight of 325.41 g/mol. Its IUPAC name is N-(2-ethylphenyl)-4-[[(2R)-oxolan-2-yl]methoxy]benzamide.
| Compound Name | N-(2-ethylphenyl)-4-[[(2R)-oxolan-2-yl]methoxy]benzamide |
|---|---|
| PubChem CID | 7750856 |
| Molecular Formula | C20H23NO3 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.17 |
| IUPAC Name | N-(2-ethylphenyl)-4-[[(2R)-oxolan-2-yl]methoxy]benzamide |
| SMILES | CCc1ccccc1NC(=O)c1ccc(OC[C@H]2CCCO2)cc1 |
| InChI | InChI=1S/C20H23NO3/c1-2-15-6-3-4-8-19(15)21-20(22)16-9-11-17(12-10-16)24-14-18-7-5-13-23-18/h3-4,6,8-12,18H,2,5,7,13-14H2,1H3,(H,21,22)/t18-/m1/s1 |
| InChIKey | AGAPRTHFTOFNDX-GOSISDBHSA-N |
| XLogP | 4.06 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |