C26H34N2O3 — CID 4933656
N-cyclohexyl-2-[(4-hexoxybenzoyl)amino]benzamide (PubChem CID 4933656) has the molecular formula C26H34N2O3 and a molecular weight of 422.57 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-hexoxybenzoyl)amino]benzamide.
| Compound Name | N-cyclohexyl-2-[(4-hexoxybenzoyl)amino]benzamide |
|---|---|
| PubChem CID | 4933656 |
| Molecular Formula | C26H34N2O3 |
| Molecular Weight | 422.57 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | N-cyclohexyl-2-[(4-hexoxybenzoyl)amino]benzamide |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C26H34N2O3/c1-2-3-4-10-19-31-22-17-15-20(16-18-22)25(29)28-24-14-9-8-13-23(24)26(30)27-21-11-6-5-7-12-21/h8-9,13-18,21H,2-7,10-12,19H2,1H3,(H,27,30)(H,28,29) |
| InChIKey | ZSGHTTZHZMHWCR-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.57 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|