C22H24N2O4 — CID 17178227
methyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoate (PubChem CID 17178227) has the molecular formula C22H24N2O4 and a molecular weight of 380.44 g/mol. Its IUPAC name is methyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 17178227 |
| Molecular Formula | C22H24N2O4 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | methyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2ccccc2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C22H24N2O4/c1-28-22(27)16-13-11-15(12-14-16)20(25)24-19-10-6-5-9-18(19)21(26)23-17-7-3-2-4-8-17/h5-6,9-14,17H,2-4,7-8H2,1H3,(H,23,26)(H,24,25) |
| InChIKey | XLMULQLWJWGQCO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |