C19H21N3O2 — CID 4922643
N-[2-(cyclohexylcarbamoyl)phenyl]pyridine-3-carboxamide (PubChem CID 4922643) has the molecular formula C19H21N3O2 and a molecular weight of 323.40 g/mol. Its IUPAC name is N-[2-(cyclohexylcarbamoyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[2-(cyclohexylcarbamoyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 4922643 |
| Molecular Formula | C19H21N3O2 |
| Molecular Weight | 323.40 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | N-[2-(cyclohexylcarbamoyl)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1C(=O)NC1CCCCC1)c1cccnc1 |
| InChI | InChI=1S/C19H21N3O2/c23-18(14-7-6-12-20-13-14)22-17-11-5-4-10-16(17)19(24)21-15-8-2-1-3-9-15/h4-7,10-13,15H,1-3,8-9H2,(H,21,24)(H,22,23) |
| InChIKey | HEVAYSNYCGRSMD-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.40 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |