C22H26N2O2 — CID 100720174
N-[2-(cyclohexylcarbamoyl)phenyl]-2,4-dimethylbenzamide (PubChem CID 100720174) has the molecular formula C22H26N2O2 and a molecular weight of 350.46 g/mol. Its IUPAC name is N-[2-(cyclohexylcarbamoyl)phenyl]-2,4-dimethylbenzamide.
| Compound Name | N-[2-(cyclohexylcarbamoyl)phenyl]-2,4-dimethylbenzamide |
|---|---|
| PubChem CID | 100720174 |
| Molecular Formula | C22H26N2O2 |
| Molecular Weight | 350.46 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | N-[2-(cyclohexylcarbamoyl)phenyl]-2,4-dimethylbenzamide |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2C(=O)NC2CCCCC2)c(C)c1 |
| InChI | InChI=1S/C22H26N2O2/c1-15-12-13-18(16(2)14-15)21(25)24-20-11-7-6-10-19(20)22(26)23-17-8-4-3-5-9-17/h6-7,10-14,17H,3-5,8-9H2,1-2H3,(H,23,26)(H,24,25) |
| InChIKey | VUSPRFKMMACCRW-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.46 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |