C29H33N3O4S — CID 126035099
2-[[2-[N-(benzenesulfonyl)-2,4-dimethylanilino]acetyl]amino]-N-cyclohexylbenzamide (PubChem CID 126035099) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-2,4-dimethylanilino]acetyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-2,4-dimethylanilino]acetyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 126035099 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-2,4-dimethylanilino]acetyl]amino]-N-cyclohexylbenzamide |
| SMILES | Cc1ccc(N(CC(=O)Nc2ccccc2C(=O)NC2CCCCC2)S(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C29H33N3O4S/c1-21-17-18-27(22(2)19-21)32(37(35,36)24-13-7-4-8-14-24)20-28(33)31-26-16-10-9-15-25(26)29(34)30-23-11-5-3-6-12-23/h4,7-10,13-19,23H,3,5-6,11-12,20H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | PVBBLWJIPUYALH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |