C29H33N3O4S — CID 126032749
N-cyclohexyl-2-[[2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 126032749) has the molecular formula C29H33N3O4S and a molecular weight of 519.67 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-2-[[2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 126032749 |
| Molecular Formula | C29H33N3O4S |
| Molecular Weight | 519.67 g/mol |
| Exact Mass | 519.22 |
| IUPAC Name | N-cyclohexyl-2-[[2-(3-methyl-N-(4-methylphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2C(=O)NC2CCCCC2)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H33N3O4S/c1-21-15-17-25(18-16-21)37(35,36)32(24-12-8-9-22(2)19-24)20-28(33)31-27-14-7-6-13-26(27)29(34)30-23-10-4-3-5-11-23/h6-9,12-19,23H,3-5,10-11,20H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | JISPWMUILPXLPB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.67 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |