C29H33N3O6S — CID 51362649
N-cyclohexyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]benzamide (PubChem CID 51362649) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]benzamide.
| Compound Name | N-cyclohexyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 51362649 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | N-cyclohexyl-2-[[2-(N-(3,4-dimethoxyphenyl)sulfonylanilino)acetyl]amino]benzamide |
| SMILES | COc1ccc(S(=O)(=O)N(CC(=O)Nc2ccccc2C(=O)NC2CCCCC2)c2ccccc2)cc1OC |
| InChI | InChI=1S/C29H33N3O6S/c1-37-26-18-17-23(19-27(26)38-2)39(35,36)32(22-13-7-4-8-14-22)20-28(33)31-25-16-10-9-15-24(25)29(34)30-21-11-5-3-6-12-21/h4,7-10,13-19,21H,3,5-6,11-12,20H2,1-2H3,(H,30,34)(H,31,33) |
| InChIKey | VJJNWIWDWPLKDD-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |