C28H30ClN3O5S — CID 126030244
2-[[2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide (PubChem CID 126030244) has the molecular formula C28H30ClN3O5S and a molecular weight of 556.08 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 126030244 |
| Molecular Formula | C28H30ClN3O5S |
| Molecular Weight | 556.08 g/mol |
| Exact Mass | 555.16 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-5-chloro-2-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide |
| SMILES | COc1ccc(Cl)cc1N(CC(=O)Nc1ccccc1C(=O)NC1CCCCC1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C28H30ClN3O5S/c1-37-26-17-16-20(29)18-25(26)32(38(35,36)22-12-6-3-7-13-22)19-27(33)31-24-15-9-8-14-23(24)28(34)30-21-10-4-2-5-11-21/h3,6-9,12-18,21H,2,4-5,10-11,19H2,1H3,(H,30,34)(H,31,33) |
| InChIKey | AZXMNACYEKMCEO-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.08 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |