C28H31N3O5S — CID 126035456
2-[[2-[N-(benzenesulfonyl)-4-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide (PubChem CID 126035456) has the molecular formula C28H31N3O5S and a molecular weight of 521.64 g/mol. Its IUPAC name is 2-[[2-[N-(benzenesulfonyl)-4-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide.
| Compound Name | 2-[[2-[N-(benzenesulfonyl)-4-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 126035456 |
| Molecular Formula | C28H31N3O5S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | 2-[[2-[N-(benzenesulfonyl)-4-methoxyanilino]acetyl]amino]-N-cyclohexylbenzamide |
| SMILES | COc1ccc(N(CC(=O)Nc2ccccc2C(=O)NC2CCCCC2)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C28H31N3O5S/c1-36-23-18-16-22(17-19-23)31(37(34,35)24-12-6-3-7-13-24)20-27(32)30-26-15-9-8-14-25(26)28(33)29-21-10-4-2-5-11-21/h3,6-9,12-19,21H,2,4-5,10-11,20H2,1H3,(H,29,33)(H,30,32) |
| InChIKey | XJQUTJBWHXIMPT-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |