C23H27N3O3S — CID 4948989
N-cyclohexyl-2-[(4-ethoxybenzoyl)carbamothioylamino]benzamide (PubChem CID 4948989) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is N-cyclohexyl-2-[(4-ethoxybenzoyl)carbamothioylamino]benzamide.
| Compound Name | N-cyclohexyl-2-[(4-ethoxybenzoyl)carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4948989 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | N-cyclohexyl-2-[(4-ethoxybenzoyl)carbamothioylamino]benzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-2-29-18-14-12-16(13-15-18)21(27)26-23(30)25-20-11-7-6-10-19(20)22(28)24-17-8-4-3-5-9-17/h6-7,10-15,17H,2-5,8-9H2,1H3,(H,24,28)(H2,25,26,27,30) |
| InChIKey | TYHYKMMKWRDDDN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|