C21H22ClN3O2S — CID 1015644
2-[(4-chlorobenzoyl)carbamothioylamino]-N-cyclohexylbenzamide (PubChem CID 1015644) has the molecular formula C21H22ClN3O2S and a molecular weight of 415.95 g/mol. Its IUPAC name is 2-[(4-chlorobenzoyl)carbamothioylamino]-N-cyclohexylbenzamide.
| Compound Name | 2-[(4-chlorobenzoyl)carbamothioylamino]-N-cyclohexylbenzamide |
|---|---|
| PubChem CID | 1015644 |
| Molecular Formula | C21H22ClN3O2S |
| Molecular Weight | 415.95 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 2-[(4-chlorobenzoyl)carbamothioylamino]-N-cyclohexylbenzamide |
| SMILES | O=C(NC(=S)Nc1ccccc1C(=O)NC1CCCCC1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H22ClN3O2S/c22-15-12-10-14(11-13-15)19(26)25-21(28)24-18-9-5-4-8-17(18)20(27)23-16-6-2-1-3-7-16/h4-5,8-13,16H,1-3,6-7H2,(H,23,27)(H2,24,25,26,28) |
| InChIKey | KOZXONKIDYQQRA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|