C25H30BrN3O3S — CID 17352265
3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide (PubChem CID 17352265) has the molecular formula C25H30BrN3O3S and a molecular weight of 532.50 g/mol. Its IUPAC name is 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide.
| Compound Name | 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
|---|---|
| PubChem CID | 17352265 |
| Molecular Formula | C25H30BrN3O3S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 531.12 |
| IUPAC Name | 3-bromo-N-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioyl]-4-(2-methylpropoxy)benzamide |
| SMILES | CC(C)COc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)NC2CCCCC2)cc1Br |
| InChI | InChI=1S/C25H30BrN3O3S/c1-16(2)15-32-22-13-12-17(14-20(22)26)23(30)29-25(33)28-21-11-7-6-10-19(21)24(31)27-18-8-4-3-5-9-18/h6-7,10-14,16,18H,3-5,8-9,15H2,1-2H3,(H,27,31)(H2,28,29,30,33) |
| InChIKey | YMHOUYVBNGEKKZ-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|