C26H26BrN3O3S — CID 17339613
3-bromo-4-(3-methylbutoxy)-N-[[2-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 17339613) has the molecular formula C26H26BrN3O3S and a molecular weight of 540.48 g/mol. Its IUPAC name is 3-bromo-4-(3-methylbutoxy)-N-[[2-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-(3-methylbutoxy)-N-[[2-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17339613 |
| Molecular Formula | C26H26BrN3O3S |
| Molecular Weight | 540.48 g/mol |
| Exact Mass | 539.09 |
| IUPAC Name | 3-bromo-4-(3-methylbutoxy)-N-[[2-(phenylcarbamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)Nc2ccccc2C(=O)Nc2ccccc2)cc1Br |
| InChI | InChI=1S/C26H26BrN3O3S/c1-17(2)14-15-33-23-13-12-18(16-21(23)27)24(31)30-26(34)29-22-11-7-6-10-20(22)25(32)28-19-8-4-3-5-9-19/h3-13,16-17H,14-15H2,1-2H3,(H,28,32)(H2,29,30,31,34) |
| InChIKey | XTEPPVRBOGAJAY-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.48 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|