C32H32N4O3S — CID 4944648
N-(4-anilinophenyl)-2-[[2-(3-methylbutoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 4944648) has the molecular formula C32H32N4O3S and a molecular weight of 552.70 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[2-(3-methylbutoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[2-(3-methylbutoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 4944648 |
| Molecular Formula | C32H32N4O3S |
| Molecular Weight | 552.70 g/mol |
| Exact Mass | 552.22 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[2-(3-methylbutoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | CC(C)CCOc1ccccc1C(=O)NC(=S)Nc1ccccc1C(=O)Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H32N4O3S/c1-22(2)20-21-39-29-15-9-7-13-27(29)31(38)36-32(40)35-28-14-8-6-12-26(28)30(37)34-25-18-16-24(17-19-25)33-23-10-4-3-5-11-23/h3-19,22,33H,20-21H2,1-2H3,(H,34,37)(H2,35,36,38,40) |
| InChIKey | NDTNLMBWGHITJA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.70 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|