C35H30N4O3S — CID 19628505
N-(4-anilinophenyl)-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 19628505) has the molecular formula C35H30N4O3S and a molecular weight of 586.72 g/mol. Its IUPAC name is N-(4-anilinophenyl)-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-(4-anilinophenyl)-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 19628505 |
| Molecular Formula | C35H30N4O3S |
| Molecular Weight | 586.72 g/mol |
| Exact Mass | 586.20 |
| IUPAC Name | N-(4-anilinophenyl)-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | O=C(Nc1ccc(Nc2ccccc2)cc1)c1ccccc1NC(=S)NC(=O)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C35H30N4O3S/c40-33(37-28-21-19-27(20-22-28)36-26-13-5-2-6-14-26)29-15-7-9-17-31(29)38-35(43)39-34(41)30-16-8-10-18-32(30)42-24-23-25-11-3-1-4-12-25/h1-22,36H,23-24H2,(H,37,40)(H2,38,39,41,43) |
| InChIKey | IQTBCFMWDCERED-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 91.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.72 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|