C29H31N3O3S — CID 19628457
N-cyclohexyl-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide (PubChem CID 19628457) has the molecular formula C29H31N3O3S and a molecular weight of 501.65 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide.
| Compound Name | N-cyclohexyl-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
|---|---|
| PubChem CID | 19628457 |
| Molecular Formula | C29H31N3O3S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.21 |
| IUPAC Name | N-cyclohexyl-2-[[2-(2-phenylethoxy)benzoyl]carbamothioylamino]benzamide |
| SMILES | O=C(NC1CCCCC1)c1ccccc1NC(=S)NC(=O)c1ccccc1OCCc1ccccc1 |
| InChI | InChI=1S/C29H31N3O3S/c33-27(30-22-13-5-2-6-14-22)23-15-7-9-17-25(23)31-29(36)32-28(34)24-16-8-10-18-26(24)35-20-19-21-11-3-1-4-12-21/h1,3-4,7-12,15-18,22H,2,5-6,13-14,19-20H2,(H,30,33)(H2,31,32,34,36) |
| InChIKey | SSVHAOBPBVPVQP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|