C27H33N3O4S — CID 4934795
3-phenylpropyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate (PubChem CID 4934795) has the molecular formula C27H33N3O4S and a molecular weight of 495.65 g/mol. Its IUPAC name is 3-phenylpropyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate.
| Compound Name | 3-phenylpropyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 4934795 |
| Molecular Formula | C27H33N3O4S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-phenylpropyl 4-[[2-(cyclohexylcarbamoyl)phenyl]carbamothioylamino]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCCCc1ccccc1)NC(=S)Nc1ccccc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C27H33N3O4S/c31-24(17-18-25(32)34-19-9-12-20-10-3-1-4-11-20)30-27(35)29-23-16-8-7-15-22(23)26(33)28-21-13-5-2-6-14-21/h1,3-4,7-8,10-11,15-16,21H,2,5-6,9,12-14,17-19H2,(H,28,33)(H2,29,30,31,35) |
| InChIKey | KOOUYYYPXLNBPJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|