C30H33N3O4S — CID 4923432
3-phenylpropyl 5-[[2-[benzyl(methyl)carbamoyl]phenyl]carbamothioylamino]-5-oxopentanoate (PubChem CID 4923432) has the molecular formula C30H33N3O4S and a molecular weight of 531.68 g/mol. Its IUPAC name is 3-phenylpropyl 5-[[2-[benzyl(methyl)carbamoyl]phenyl]carbamothioylamino]-5-oxopentanoate.
| Compound Name | 3-phenylpropyl 5-[[2-[benzyl(methyl)carbamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 4923432 |
| Molecular Formula | C30H33N3O4S |
| Molecular Weight | 531.68 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | 3-phenylpropyl 5-[[2-[benzyl(methyl)carbamoyl]phenyl]carbamothioylamino]-5-oxopentanoate |
| SMILES | CN(Cc1ccccc1)C(=O)c1ccccc1NC(=S)NC(=O)CCCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C30H33N3O4S/c1-33(22-24-14-6-3-7-15-24)29(36)25-17-8-9-18-26(25)31-30(38)32-27(34)19-10-20-28(35)37-21-11-16-23-12-4-2-5-13-23/h2-9,12-15,17-18H,10-11,16,19-22H2,1H3,(H2,31,32,34,38) |
| InChIKey | OLYPUXHDIRIFSL-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.68 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|