C25H29N3O4S — CID 4923420
3-phenylpropyl 5-oxo-5-[[2-(prop-2-enylcarbamoyl)phenyl]carbamothioylamino]pentanoate (PubChem CID 4923420) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is 3-phenylpropyl 5-oxo-5-[[2-(prop-2-enylcarbamoyl)phenyl]carbamothioylamino]pentanoate.
| Compound Name | 3-phenylpropyl 5-oxo-5-[[2-(prop-2-enylcarbamoyl)phenyl]carbamothioylamino]pentanoate |
|---|---|
| PubChem CID | 4923420 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | 3-phenylpropyl 5-oxo-5-[[2-(prop-2-enylcarbamoyl)phenyl]carbamothioylamino]pentanoate |
| SMILES | C=CCNC(=O)c1ccccc1NC(=S)NC(=O)CCCC(=O)OCCCc1ccccc1 |
| InChI | InChI=1S/C25H29N3O4S/c1-2-17-26-24(31)20-13-6-7-14-21(20)27-25(33)28-22(29)15-8-16-23(30)32-18-9-12-19-10-4-3-5-11-19/h2-7,10-11,13-14H,1,8-9,12,15-18H2,(H,26,31)(H2,27,28,29,33) |
| InChIKey | RSZIWXKAOKECMC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|