C19H27N3O2S — CID 4958966
2-(octanoylcarbamothioylamino)-N-prop-2-enylbenzamide (PubChem CID 4958966) has the molecular formula C19H27N3O2S and a molecular weight of 361.51 g/mol. Its IUPAC name is 2-(octanoylcarbamothioylamino)-N-prop-2-enylbenzamide.
| Compound Name | 2-(octanoylcarbamothioylamino)-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4958966 |
| Molecular Formula | C19H27N3O2S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 2-(octanoylcarbamothioylamino)-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=S)NC(=O)CCCCCCC |
| InChI | InChI=1S/C19H27N3O2S/c1-3-5-6-7-8-13-17(23)22-19(25)21-16-12-10-9-11-15(16)18(24)20-14-4-2/h4,9-12H,2-3,5-8,13-14H2,1H3,(H,20,24)(H2,21,22,23,25) |
| InChIKey | XBMGQCGTRBEOIV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|