C18H16IN3O2S — CID 4932651
2-[(2-iodobenzoyl)carbamothioylamino]-N-prop-2-enylbenzamide (PubChem CID 4932651) has the molecular formula C18H16IN3O2S and a molecular weight of 465.32 g/mol. Its IUPAC name is 2-[(2-iodobenzoyl)carbamothioylamino]-N-prop-2-enylbenzamide.
| Compound Name | 2-[(2-iodobenzoyl)carbamothioylamino]-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 4932651 |
| Molecular Formula | C18H16IN3O2S |
| Molecular Weight | 465.32 g/mol |
| Exact Mass | 465.00 |
| IUPAC Name | 2-[(2-iodobenzoyl)carbamothioylamino]-N-prop-2-enylbenzamide |
| SMILES | C=CCNC(=O)c1ccccc1NC(=S)NC(=O)c1ccccc1I |
| InChI | InChI=1S/C18H16IN3O2S/c1-2-11-20-16(23)13-8-4-6-10-15(13)21-18(25)22-17(24)12-7-3-5-9-14(12)19/h2-10H,1,11H2,(H,20,23)(H2,21,22,24,25) |
| InChIKey | VNIBAECMLARBAD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.32 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|